EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N3O |
| Net Charge | +1 |
| Average Mass | 310.421 |
| Monoisotopic Mass | 310.19139 |
| SMILES | C[NH+](C)CCCOc1nn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C19H23N3O/c1-21(2)13-8-14-23-19-17-11-6-7-12-18(17)22(20-19)15-16-9-4-3-5-10-16/h3-7,9-12H,8,13-15H2,1-2H3/p+1 |
| InChIKey | CNBGNNVCVSKAQZ-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzydamine(1+) (CHEBI:134500) is a ammonium ion derivative (CHEBI:35274) |
| benzydamine(1+) (CHEBI:134500) is a organic cation (CHEBI:25697) |
| benzydamine(1+) (CHEBI:134500) is conjugate acid of benzydamine (CHEBI:94563) |
| Incoming Relation(s) |
| benzydamine (CHEBI:94563) is conjugate base of benzydamine(1+) (CHEBI:134500) |
| IUPAC Name |
|---|
| 3-[(1-benzyl-1H-indazol-3-yl)oxy]-N,N-dimethylpropan-1-aminium |
| UniProt Name | Source |
|---|---|
| benzydamine | UniProt |
| Citations |
|---|