EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O4 |
| Net Charge | 0 |
| Average Mass | 338.488 |
| Monoisotopic Mass | 338.24571 |
| SMILES | CCCCC/C=C\C[C@@H](O)CC/C=C/C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H34O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h6-9,11,15,18-19,21-22H,2-5,10,12-14,16-17H2,1H3,(H,23,24)/b8-7+,9-6-,15-11-/t18-,19-/m1/s1 |
| InChIKey | NKUPFHTVILUPKF-GWURPDJQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (12709426) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10,11-dihydroleukotriene B4 (CHEBI:134444) has role human urinary metabolite (CHEBI:84087) |
| 10,11-dihydroleukotriene B4 (CHEBI:134444) has role human xenobiotic metabolite (CHEBI:76967) |
| 10,11-dihydroleukotriene B4 (CHEBI:134444) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| 10,11-dihydroleukotriene B4 (CHEBI:134444) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 10,11-dihydroleukotriene B4 (CHEBI:134444) is a leukotriene (CHEBI:25029) |
| 10,11-dihydroleukotriene B4 (CHEBI:134444) is a long-chain fatty acid (CHEBI:15904) |
| 10,11-dihydroleukotriene B4 (CHEBI:134444) is conjugate acid of 10,11-dihydroleukotriene B4(1−) (CHEBI:133324) |
| Incoming Relation(s) |
| 10,11-dihydroleukotriene B4(1−) (CHEBI:133324) is conjugate base of 10,11-dihydroleukotriene B4 (CHEBI:134444) |
| IUPAC Name |
|---|
| (5S,6Z,8E,12S,14Z)-5,12-dihydroxyicosa-6,8,14-trienoic acid |
| Synonyms | Source |
|---|---|
| 10,11-dihydro-leukotriene B4 | ChEBI |
| 10,11-dihydro-LTB4 | ChEBI |
| 5,12-Dihydroxy-6,8,14-eicosatrienoic acid | ChemIDplus |
| DHLTB4 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0012504 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5278811 | Reaxys |
| CAS:120904-46-3 | ChemIDplus |
| Citations |
|---|