EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O4 |
| Net Charge | -1 |
| Average Mass | 337.480 |
| Monoisotopic Mass | 337.23843 |
| SMILES | CCCCC/C=C\C[C@@H](O)CC/C=C/C=C\[C@@H](O)CCCC(=O)[O-] |
| InChI | InChI=1S/C20H34O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h6-9,11,15,18-19,21-22H,2-5,10,12-14,16-17H2,1H3,(H,23,24)/p-1/b8-7+,9-6-,15-11-/t18-,19-/m1/s1 |
| InChIKey | NKUPFHTVILUPKF-GWURPDJQSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10,11-dihydroleukotriene B4(1−) (CHEBI:133324) is a icosanoid anion (CHEBI:62937) |
| 10,11-dihydroleukotriene B4(1−) (CHEBI:133324) is conjugate base of 10,11-dihydroleukotriene B4 (CHEBI:134444) |
| Incoming Relation(s) |
| 10,11-dihydroleukotriene B4 (CHEBI:134444) is conjugate acid of 10,11-dihydroleukotriene B4(1−) (CHEBI:133324) |
| IUPAC Name |
|---|
| (5S,6Z,8E,12S,14Z)-5,12-dihydroxyicosa-6,8,14-trienoate |
| Synonyms | Source |
|---|---|
| 10,11-dihydro-leukotriene B4(1−) | ChEBI |
| 10,11-dihydro-LTB4(1−) | ChEBI |
| (5S,12S)-dihydroxy-(6Z,8E,14Z)-icosatrienoate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 10,11-dihydro-leukotriene B4 | UniProt |