EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H39NO6S |
| Net Charge | 0 |
| Average Mass | 457.633 |
| Monoisotopic Mass | 457.24981 |
| SMILES | CCCCC/C=C\C[C@@H](O)C/C=C/C=C/[C@@H](SC[C@H](N)C(=O)O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C23H39NO6S/c1-2-3-4-5-6-8-12-18(25)13-9-7-10-15-21(31-17-19(24)23(29)30)20(26)14-11-16-22(27)28/h6-10,15,18-21,25-26H,2-5,11-14,16-17,24H2,1H3,(H,27,28)(H,29,30)/b8-6-,9-7+,15-10+/t18-,19+,20+,21-/m1/s1 |
| InChIKey | FZJOTYMARNGISF-SHPAXQKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (8244977) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (12R)-hydroxy-10,11-dihydroleukotriene E4 (CHEBI:134418) has role human xenobiotic metabolite (CHEBI:76967) |
| (12R)-hydroxy-10,11-dihydroleukotriene E4 (CHEBI:134418) is a L-cysteine thioether (CHEBI:27532) |
| (12R)-hydroxy-10,11-dihydroleukotriene E4 (CHEBI:134418) is a amino dicarboxylic acid (CHEBI:36164) |
| (12R)-hydroxy-10,11-dihydroleukotriene E4 (CHEBI:134418) is a diol (CHEBI:23824) |
| (12R)-hydroxy-10,11-dihydroleukotriene E4 (CHEBI:134418) is a leukotriene (CHEBI:25029) |
| (12R)-hydroxy-10,11-dihydroleukotriene E4 (CHEBI:134418) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| (12R)-hydroxy-10,11-dihydroleukotriene E4 (CHEBI:134418) is a secondary alcohol (CHEBI:35681) |
| (12R)-hydroxy-10,11-dihydroleukotriene E4 (CHEBI:134418) is conjugate acid of (12R)-hydroxy-10,11-dihydroleukotriene E4(1−) (CHEBI:133320) |
| Incoming Relation(s) |
| (12R)-hydroxy-10,11-dihydroleukotriene E4(1−) (CHEBI:133320) is conjugate base of (12R)-hydroxy-10,11-dihydroleukotriene E4 (CHEBI:134418) |
| IUPAC Name |
|---|
| (5S,6R,7E,9E,12R,14Z)-6-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}-5,12-dihydroxyicosa-7,9,14-trienoic acid |
| Synonyms | Source |
|---|---|
| 5,12-Dihydroxy-6-cysteinyl-7,9,14-eicosatrienoic acid | HMDB |
| 5S,12R-Dihydroxy-6-S-cysteinyl-7E,9E,14Z-eicosatrienoic acid | HMDB |
| (5S,6R,12R)-Dihydroxy-6-(S-cysteinyl)-(7E,9E,14Z)-eicosatrienoic acid | HMDB |
| ELTB3 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0012501 | HMDB |
| Citations |
|---|