EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H38NO6S |
| Net Charge | -1 |
| Average Mass | 456.625 |
| Monoisotopic Mass | 456.24253 |
| SMILES | CCCCC/C=C\C[C@@H](O)C/C=C/C=C/[C@@H](SC[C@H]([NH3+])C(=O)[O-])[C@@H](O)CCCC(=O)[O-] |
| InChI | InChI=1S/C23H39NO6S/c1-2-3-4-5-6-8-12-18(25)13-9-7-10-15-21(31-17-19(24)23(29)30)20(26)14-11-16-22(27)28/h6-10,15,18-21,25-26H,2-5,11-14,16-17,24H2,1H3,(H,27,28)(H,29,30)/p-1/b8-6-,9-7+,15-10+/t18-,19+,20+,21-/m1/s1 |
| InChIKey | FZJOTYMARNGISF-SHPAXQKOSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (12R)-hydroxy-10,11-dihydroleukotriene E4(1−) (CHEBI:133320) is a dicarboxylic acid monoanion (CHEBI:35695) |
| (12R)-hydroxy-10,11-dihydroleukotriene E4(1−) (CHEBI:133320) is a icosanoid anion (CHEBI:62937) |
| (12R)-hydroxy-10,11-dihydroleukotriene E4(1−) (CHEBI:133320) is conjugate base of (12R)-hydroxy-10,11-dihydroleukotriene E4 (CHEBI:134418) |
| Incoming Relation(s) |
| (12R)-hydroxy-10,11-dihydroleukotriene E4 (CHEBI:134418) is conjugate acid of (12R)-hydroxy-10,11-dihydroleukotriene E4(1−) (CHEBI:133320) |
| IUPAC Name |
|---|
| (5S,6R,7E,9E,12R,14Z)-6-{[(2R)-2-azaniumyl-2-carboxylatoethyl]sulfanyl}-5,12-dihydroxyicosa-7,9,14-trienoate |
| Synonym | Source |
|---|---|
| (5S,12R)-dihydroxy-(6R)-cysteinyl-(7E,9E,14Z)-icosatrienoate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 10,11-dihydro-(12R)-hydroxy-leukotriene E4 | UniProt |