EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5ClO4 |
| Net Charge | 0 |
| Average Mass | 176.555 |
| Monoisotopic Mass | 175.98764 |
| SMILES | O=C1C=CC(C(Cl)C(=O)O)O1 |
| InChI | InChI=1S/C6H5ClO4/c7-5(6(9)10)3-1-2-4(8)11-3/h1-3,5H,(H,9,10) |
| InChIKey | KGCZGOVWTWDEQD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-chloromuconolactone (CHEBI:134415) has functional parent 5-oxo-2,5-dihydro-2-furylacetic acid (CHEBI:18080) |
| 5-chloromuconolactone (CHEBI:134415) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 5-chloromuconolactone (CHEBI:134415) is a 5-oxo-2-furylacetic acid (CHEBI:23730) |
| 5-chloromuconolactone (CHEBI:134415) is a chlorocarboxylic acid (CHEBI:36685) |
| 5-chloromuconolactone (CHEBI:134415) is conjugate acid of 5-chloromuconolactone(1−) (CHEBI:133250) |
| Incoming Relation(s) |
| 5-chloromuconolactone(1−) (CHEBI:133250) is conjugate base of 5-chloromuconolactone (CHEBI:134415) |
| IUPAC Name |
|---|
| chloro(5-oxo-2,5-dihydrofuran-2-yl)acetic acid |
| Citations |
|---|