EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4ClO4 |
| Net Charge | -1 |
| Average Mass | 175.547 |
| Monoisotopic Mass | 174.98036 |
| SMILES | O=C1C=CC(C(Cl)C(=O)[O-])O1 |
| InChI | InChI=1S/C6H5ClO4/c7-5(6(9)10)3-1-2-4(8)11-3/h1-3,5H,(H,9,10)/p-1 |
| InChIKey | KGCZGOVWTWDEQD-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhodococcus opacus (ncbitaxon:37919) | - | PubMed (12218013) |
| Roles Classification |
|---|
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-chloromuconolactone(1−) (CHEBI:133250) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 5-chloromuconolactone(1−) (CHEBI:133250) is a monocarboxylic acid anion (CHEBI:35757) |
| 5-chloromuconolactone(1−) (CHEBI:133250) is conjugate base of 5-chloromuconolactone (CHEBI:134415) |
| Incoming Relation(s) |
| 5-chloromuconolactone (CHEBI:134415) is conjugate acid of 5-chloromuconolactone(1−) (CHEBI:133250) |
| Synonyms | Source |
|---|---|
| 5-chloromuconolactone anion | ChEBI |
| chloro(5-oxo-2,5-dihydrofuran-2-yl)acetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25133429 | Reaxys |
| Citations |
|---|