EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O6 |
| Net Charge | 0 |
| Average Mass | 366.454 |
| Monoisotopic Mass | 366.20424 |
| SMILES | CC/C=C\C[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H]2C[C@H]1OO2)OO |
| InChI | InChI=1S/C20H30O6/c1-2-3-6-9-15(24-23)12-13-17-16(18-14-19(17)26-25-18)10-7-4-5-8-11-20(21)22/h3-4,6-7,12-13,15-19,23H,2,5,8-11,14H2,1H3,(H,21,22)/b6-3-,7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | LRRNKTJTXRCNJX-SAMSIYEGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin G3 (CHEBI:134406) is a hydroperoxy polyunsaturated fatty acid (CHEBI:189832) |
| prostaglandin G3 (CHEBI:134406) is a olefinic compound (CHEBI:78840) |
| prostaglandin G3 (CHEBI:134406) is a prostaglandins G (CHEBI:26343) |
| prostaglandin G3 (CHEBI:134406) is conjugate acid of prostaglandin G3(1−) (CHEBI:133133) |
| Incoming Relation(s) |
| prostaglandin G3(1−) (CHEBI:133133) is conjugate base of prostaglandin G3 (CHEBI:134406) |
| IUPAC Name |
|---|
| (5Z)-7-{(1R,4S,5R,6R)-6-[(1E,3S,,5Z)-3-hydroperoxyocta-1,5-dien-1-yl]-2,3-dioxabicyclo[2.2.1]heptan-5-yl}hept-5-enoic acid |
| Synonyms | Source |
|---|---|
| (5Z,9S,11R,13E,15S,17Z)-15-hydroperoxy-9,11-epidioxyprosta-5,13,17-trienoic acid | ChEBI |
| PGG3 | ChEBI |