EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36N2O4 |
| Net Charge | 0 |
| Average Mass | 440.584 |
| Monoisotopic Mass | 440.26751 |
| SMILES | COc1ccc(CCNCCC[C@](C#N)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC |
| InChI | InChI=1S/C26H36N2O4/c1-19(2)26(18-27,21-9-11-23(30-4)25(17-21)32-6)13-7-14-28-15-12-20-8-10-22(29-3)24(16-20)31-5/h8-11,16-17,19,28H,7,12-15H2,1-6H3/t26-/m1/s1 |
| InChIKey | UPKQNCPKPOLASS-AREMUKBSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-norverapamil (CHEBI:134082) is a 2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-2-(propan-2-yl)pentanenitrile (CHEBI:134080) |
| (R)-norverapamil (CHEBI:134082) is enantiomer of (S)-norverapamil (CHEBI:134081) |
| Incoming Relation(s) |
| norverapamil (CHEBI:132050) has part (R)-norverapamil (CHEBI:134082) |
| (S)-norverapamil (CHEBI:134081) is enantiomer of (R)-norverapamil (CHEBI:134082) |
| IUPAC Name |
|---|
| (2R)-2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-2-(propan-2-yl)pentanenitrile |
| Synonyms | Source |
|---|---|
| Agi-003 | ChemIDplus |
| Arverapamil | ChemIDplus |
| (+)-desmethylverapamil | ChEBI |
| (R)-desmethylverapamil | ChEBI |
| (+)-norverapamil | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6962314 | Reaxys |
| CAS:123932-43-4 | ChemIDplus |
| Citations |
|---|