EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15NO5 |
| Net Charge | 0 |
| Average Mass | 265.265 |
| Monoisotopic Mass | 265.09502 |
| SMILES | C/C=C/c1c(C)c(OC)c(C(=O)O)c(C(N)=O)c1O |
| InChI | InChI=1S/C13H15NO5/c1-4-5-7-6(2)11(19-3)9(13(17)18)8(10(7)15)12(14)16/h4-5,15H,1-3H3,(H2,14,16)(H,17,18)/b5-4+ |
| InChIKey | UOIRNFVLBXIGKH-SNAWJCMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (12458767) | Strain: CFR-W-105 |
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. EC 1.1.1.21 (aldehyde reductase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of aldehyde reductase (EC 1.1.1.21). Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nigerloxin (CHEBI:133971) has role Aspergillus metabolite (CHEBI:76956) |
| nigerloxin (CHEBI:133971) has role antioxidant (CHEBI:22586) |
| nigerloxin (CHEBI:133971) has role EC 1.1.1.21 (aldehyde reductase) inhibitor (CHEBI:48550) |
| nigerloxin (CHEBI:133971) has role lipoxygenase inhibitor (CHEBI:35856) |
| nigerloxin (CHEBI:133971) has role radical scavenger (CHEBI:48578) |
| nigerloxin (CHEBI:133971) is a aromatic ether (CHEBI:35618) |
| nigerloxin (CHEBI:133971) is a benzamides (CHEBI:22702) |
| nigerloxin (CHEBI:133971) is a benzoic acids (CHEBI:22723) |
| nigerloxin (CHEBI:133971) is a phenols (CHEBI:33853) |
| nigerloxin (CHEBI:133971) is a styrenes (CHEBI:26799) |
| IUPAC Name |
|---|
| 2-carbamoyl-3-hydroxy-6-methoxy-5-methyl-4-[(1E)-prop-1-en-1-yl]benzoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9342829 | Reaxys |
| Citations |
|---|