EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H39NO9 |
| Net Charge | 0 |
| Average Mass | 593.673 |
| Monoisotopic Mass | 593.26248 |
| SMILES | [H][C@@]12C[C@H](O)[C@@]3(C)Oc4cc(-c5cccnc5)oc(=O)c4[C@H](O)[C@]3([H])[C@@]1(C)CC[C@H](OC(=O)C1CC1)[C@@]2(C)COC(=O)C1CC1 |
| InChI | InChI=1S/C33H39NO9/c1-31-11-10-24(42-29(38)18-8-9-18)32(2,16-40-28(37)17-6-7-17)22(31)14-23(35)33(3)27(31)26(36)25-21(43-33)13-20(41-30(25)39)19-5-4-12-34-15-19/h4-5,12-13,15,17-18,22-24,26-27,35-36H,6-11,14,16H2,1-3H3/t22-,23+,24+,26+,27-,31+,32+,33-/m1/s1 |
| InChIKey | LRZWFURXIMFONG-HRSIRGMGSA-N |
| Roles Classification |
|---|
| Biological Role: | TRPV channel modulator Any transient receptor potential (TRP) channel modulator that modulates the TRPV channels (V = vanilloid). There is strong evidence that action at one or more of this class of proteins is responsible for the insecticidal action of pymetrozine, pyrifluquinazon, and afidopyropen. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| afidopyropen (CHEBI:133859) has role agrochemical (CHEBI:33286) |
| afidopyropen (CHEBI:133859) has role insecticide (CHEBI:24852) |
| afidopyropen (CHEBI:133859) has role TRPV channel modulator (CHEBI:142782) |
| afidopyropen (CHEBI:133859) is a cyclopropanecarboxylate ester (CHEBI:50351) |
| afidopyropen (CHEBI:133859) is a organic heterotetracyclic compound (CHEBI:38163) |
| afidopyropen (CHEBI:133859) is a pyridines (CHEBI:26421) |
| afidopyropen (CHEBI:133859) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| [(3S,4R,4aR,6S,6aS,12R,12aS,12bS)-3-[(cyclopropylcarbonyl)oxy]-6,12-dihydroxy-4,6a,12b-trimethyl-11-oxo-9-(pyridin-3-yl)-1,3,4,4a,5,6,6a,12,12a,12b-decahydro-2H,11H-benzo[f]pyrano[4,3-b]chromen-4-yl]methyl cyclopropanecarboxylate |
| Synonyms | Source |
|---|---|
| [(3S,4R,4aR,6S,6aS,12R,12aS,12bS)-3-(cyclopropylcarbonyloxy)-1,2,3,4,4a,5,6,6a,12a,12b-decahydro-6,12-dihydroxy-4,6a,12b-trimethyl-11-oxo-9-(3-pyridyl)-11H,12H-benzo[f]pyrano[4,3-b]chromen-4-yl]methyl cyclopropanecarboxylate | Alan Wood's Pesticides |
| [(3S,4R,4aR,6S,6aS,12R,12aS,12bS)-3-[(cyclopropylcarbonyl)oxy]-1,3,4,4a,5,6,6a,12,12a,12b-decahydro-6,12-dihydroxy-4,6a,12b-trimethyl-11-oxo-9-(3-pyridinyl)-2H,11H-naphtho[2,1-b]pyrano[3,4-e]pyran-4-yl]methyl cyclopropanecarboxylate | Alan Wood's Pesticides |
| afidopyropène | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2636 | PPDB |
| afidopyropen | Alan Wood's Pesticides |
| EP2119361 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21172253 | Reaxys |
| CAS:915972-17-7 | Alan Wood's Pesticides |
| Citations |
|---|