EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O5 |
| Net Charge | 0 |
| Average Mass | 250.250 |
| Monoisotopic Mass | 250.08412 |
| SMILES | CC(O)CC1=CC2=CC(=O)C(C)(O)C(=O)C2=CO1 |
| InChI | InChI=1S/C13H14O5/c1-7(14)3-9-4-8-5-11(15)13(2,17)12(16)10(8)6-18-9/h4-7,14,17H,3H2,1-2H3 |
| InChIKey | HKWLGNSOBJZTNG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (22921072) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azanigerone E (CHEBI:133856) has role Aspergillus metabolite (CHEBI:76956) |
| azanigerone E (CHEBI:133856) is a 2-benzopyran (CHEBI:38444) |
| azanigerone E (CHEBI:133856) is a azaphilone (CHEBI:50941) |
| azanigerone E (CHEBI:133856) is a cyclic ketone (CHEBI:3992) |
| azanigerone E (CHEBI:133856) is a polyketide (CHEBI:26188) |
| azanigerone E (CHEBI:133856) is a secondary alcohol (CHEBI:35681) |
| azanigerone E (CHEBI:133856) is a tertiary alcohol (CHEBI:26878) |
| azanigerone E (CHEBI:133856) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| azanigerone E (CHEBI:133856) is a β-diketone (CHEBI:67265) |
| IUPAC Name |
|---|
| 7-hydroxy-3-(2-hydroxypropyl)-7-methyl-6H-2-benzopyran-6,8(7H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22929037 | Reaxys |
| Citations |
|---|