EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O7 |
| Net Charge | 0 |
| Average Mass | 392.448 |
| Monoisotopic Mass | 392.18350 |
| SMILES | CCC(C)CC(C)C(=O)OC1(C)C(=O)C=C2C=C(C(O)C(C)O)OC=C2C1=O |
| InChI | InChI=1S/C21H28O7/c1-6-11(2)7-12(3)20(26)28-21(5)17(23)9-14-8-16(18(24)13(4)22)27-10-15(14)19(21)25/h8-13,18,22,24H,6-7H2,1-5H3 |
| InChIKey | BQPLVAHGIZMMKM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (22921072) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azanigerone C (CHEBI:133854) has role Aspergillus metabolite (CHEBI:76956) |
| azanigerone C (CHEBI:133854) is a 2-benzopyran (CHEBI:38444) |
| azanigerone C (CHEBI:133854) is a azaphilone (CHEBI:50941) |
| azanigerone C (CHEBI:133854) is a carboxylic ester (CHEBI:33308) |
| azanigerone C (CHEBI:133854) is a cyclic ketone (CHEBI:3992) |
| azanigerone C (CHEBI:133854) is a glycol (CHEBI:13643) |
| azanigerone C (CHEBI:133854) is a polyketide (CHEBI:26188) |
| azanigerone C (CHEBI:133854) is a secondary alcohol (CHEBI:35681) |
| azanigerone C (CHEBI:133854) is a β-diketone (CHEBI:67265) |
| IUPAC Name |
|---|
| 3-(1,2-dihydroxypropyl)-7-methyl-6,8-dioxo-7,8-dihydro-6H-2-benzopyran-7-yl 2,4-dimethylhexanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22929035 | Reaxys |
| Citations |
|---|