EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O9S2 |
| Net Charge | -2 |
| Average Mass | 490.596 |
| Monoisotopic Mass | 490.13422 |
| SMILES | [H][C@@]12CC=C3C[C@@H](OS(=O)(=O)[O-])CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])C(=O)COS(=O)(=O)[O-] |
| InChI | InChI=1S/C21H32O9S2/c1-20-9-7-14(30-32(26,27)28)11-13(20)3-4-15-16-5-6-18(19(22)12-29-31(23,24)25)21(16,2)10-8-17(15)20/h3,14-18H,4-12H2,1-2H3,(H,23,24,25)(H,26,27,28)/p-2/t14-,15-,16-,17-,18+,20-,21-/m0/s1 |
| InChIKey | CBOVWLYQUCVTFA-WPWXJNKXSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 21-hydroxypregnenolone disulfate(2−) (CHEBI:133699) is a 21-hydroxypregnenolone disulfate anion (CHEBI:133698) |
| 21-hydroxypregnenolone disulfate(2−) (CHEBI:133699) is conjugate base of 21-hydroxypregnenolone disulfate (CHEBI:133695) |
| Incoming Relation(s) |
| 21-hydroxypregnenolone disulfate (CHEBI:133695) is conjugate acid of 21-hydroxypregnenolone disulfate(2−) (CHEBI:133699) |
| IUPAC Name |
|---|
| 20-oxopregn-5-ene-3β,21-diyl disulfate |
| Synonym | Source |
|---|---|
| (3β)-20-oxopregn-5-ene-3,21-diyl disulfate | IUPAC |