EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O9S2 |
| Net Charge | 0 |
| Average Mass | 492.612 |
| Monoisotopic Mass | 492.14877 |
| SMILES | [H][C@@]12CC=C3C[C@@H](OS(=O)(=O)O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])C(=O)COS(=O)(=O)O |
| InChI | InChI=1S/C21H32O9S2/c1-20-9-7-14(30-32(26,27)28)11-13(20)3-4-15-16-5-6-18(19(22)12-29-31(23,24)25)21(16,2)10-8-17(15)20/h3,14-18H,4-12H2,1-2H3,(H,23,24,25)(H,26,27,28)/t14-,15-,16-,17-,18+,20-,21-/m0/s1 |
| InChIKey | CBOVWLYQUCVTFA-WPWXJNKXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (9219925) |
| Roles Classification |
|---|
| Biological Role: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 21-hydroxypregnenolone disulfate (CHEBI:133695) has functional parent 21-hydroxypregnenolone (CHEBI:28043) |
| 21-hydroxypregnenolone disulfate (CHEBI:133695) has role human blood serum metabolite (CHEBI:85234) |
| 21-hydroxypregnenolone disulfate (CHEBI:133695) is a 20-oxo steroid (CHEBI:36885) |
| 21-hydroxypregnenolone disulfate (CHEBI:133695) is a steroid sulfate (CHEBI:16158) |
| 21-hydroxypregnenolone disulfate (CHEBI:133695) is conjugate acid of 21-hydroxypregnenolone disulfate anion (CHEBI:133698) |
| 21-hydroxypregnenolone disulfate (CHEBI:133695) is conjugate acid of 21-hydroxypregnenolone disulfate(2−) (CHEBI:133699) |
| Incoming Relation(s) |
| 21-hydroxypregnenolone disulfate anion (CHEBI:133698) is conjugate base of 21-hydroxypregnenolone disulfate (CHEBI:133695) |
| 21-hydroxypregnenolone disulfate(2−) (CHEBI:133699) is conjugate base of 21-hydroxypregnenolone disulfate (CHEBI:133695) |
| IUPAC Name |
|---|
| 20-oxopregn-5-ene-3β,21-diyl bis(hydrogen sulfate) |
| Synonyms | Source |
|---|---|
| (3β)-20-oxopregn-5-ene-3,21-diyl bis(hydrogen sulfate) | IUPAC |
| Pregnenolone-3,21-disulfate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6024733 | Reaxys |
| CAS:5639-07-6 | ChemIDplus |
| Citations |
|---|