EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:133691 - catechol β-D-glucuronide(1−)
| Formula | C12H13O8 |
| Net Charge | -1 |
| Average Mass | 285.228 |
| Monoisotopic Mass | 285.06159 |
| SMILES | O=C([O-])[C@H]1O[C@@H](Oc2ccccc2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H14O8/c13-5-3-1-2-4-6(5)19-12-9(16)7(14)8(15)10(20-12)11(17)18/h1-4,7-10,12-16H,(H,17,18)/p-1/t7-,8-,9+,10-,12+/m0/s1 |
| InChIKey | ICPYZFZFSLTYID-GOVZDWNOSA-M |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| catechol β-D-glucuronide(1−) (CHEBI:133691) has role mouse metabolite (CHEBI:75771) |
| catechol β-D-glucuronide(1−) (CHEBI:133691) is a carbohydrate acid derivative anion (CHEBI:63551) |
| catechol β-D-glucuronide(1−) (CHEBI:133691) is a monocarboxylic acid anion (CHEBI:35757) |
| catechol β-D-glucuronide(1−) (CHEBI:133691) is conjugate base of catechol β-D-glucuronide (CHEBI:133689) |
| Incoming Relation(s) |
| catechol β-D-glucuronide (CHEBI:133689) is conjugate acid of catechol β-D-glucuronide(1−) (CHEBI:133691) |
| IUPAC Name |
|---|
| 2-hydroxyphenyl β-D-glucopyranosiduronate |
| Synonyms | Source |
|---|---|
| catechol β-D-glucuronidate | ChEBI |
| catechol glucuronide(1−) | ChEBI |
| catechol β-glucuronide(1−) | ChEBI |
| catechol β-glucuronidate | ChEBI |
| catechol glucuronide | ChEBI |
| catechol glucuronidate | ChEBI |