EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14Cl2F2N2O3 |
| Net Charge | 0 |
| Average Mass | 439.245 |
| Monoisotopic Mass | 438.03495 |
| SMILES | COc1c(Cl)ccc(-c2nc(C(=O)OCc3ccccc3)c(Cl)c(N)c2F)c1F |
| InChI | InChI=1S/C20H14Cl2F2N2O3/c1-28-19-12(21)8-7-11(14(19)23)17-15(24)16(25)13(22)18(26-17)20(27)29-9-10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H2,25,26) |
| InChIKey | WNZCDFOXYNRBRB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| florpyrauxifen-benzyl (CHEBI:133651) has functional parent florpyrauxifen (CHEBI:133650) |
| florpyrauxifen-benzyl (CHEBI:133651) has role herbicide (CHEBI:24527) |
| florpyrauxifen-benzyl (CHEBI:133651) has role synthetic auxin (CHEBI:26841) |
| florpyrauxifen-benzyl (CHEBI:133651) is a aminopyridine (CHEBI:38207) |
| florpyrauxifen-benzyl (CHEBI:133651) is a aromatic ether (CHEBI:35618) |
| florpyrauxifen-benzyl (CHEBI:133651) is a benzyl ester (CHEBI:90628) |
| florpyrauxifen-benzyl (CHEBI:133651) is a biaryl (CHEBI:64459) |
| florpyrauxifen-benzyl (CHEBI:133651) is a monochlorobenzenes (CHEBI:83403) |
| florpyrauxifen-benzyl (CHEBI:133651) is a monofluorobenzenes (CHEBI:83575) |
| IUPAC Name |
|---|
| benzyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylate |
| Synonyms | Source |
|---|---|
| benzyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropicolinate | Alan Wood's Pesticides |
| florpyrauxifène-benzyle | ChEBI |
| phenylmethyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoro-2-pyridinecarboxylate | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| Rinskor | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3097 | PPDB |
| derivatives/florpyrauxifen-benzyl | Alan Wood's Pesticides |
| US2012190551 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22696018 | Reaxys |
| CAS:1390661-72-9 | Alan Wood's Pesticides |
| Citations |
|---|