EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8Cl2F2N2O3 |
| Net Charge | 0 |
| Average Mass | 349.120 |
| Monoisotopic Mass | 347.98800 |
| SMILES | COc1c(Cl)ccc(-c2nc(C(=O)O)c(Cl)c(N)c2F)c1F |
| InChI | InChI=1S/C13H8Cl2F2N2O3/c1-22-12-5(14)3-2-4(7(12)16)10-8(17)9(18)6(15)11(19-10)13(20)21/h2-3H,1H3,(H2,18,19)(H,20,21) |
| InChIKey | XFZUQTKDBCOXPP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| florpyrauxifen (CHEBI:133650) has role herbicide (CHEBI:24527) |
| florpyrauxifen (CHEBI:133650) has role synthetic auxin (CHEBI:26841) |
| florpyrauxifen (CHEBI:133650) is a aminopyridine (CHEBI:38207) |
| florpyrauxifen (CHEBI:133650) is a aromatic ether (CHEBI:35618) |
| florpyrauxifen (CHEBI:133650) is a biaryl (CHEBI:64459) |
| florpyrauxifen (CHEBI:133650) is a monochlorobenzenes (CHEBI:83403) |
| florpyrauxifen (CHEBI:133650) is a monofluorobenzenes (CHEBI:83575) |
| florpyrauxifen (CHEBI:133650) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Incoming Relation(s) |
| florpyrauxifen-benzyl (CHEBI:133651) has functional parent florpyrauxifen (CHEBI:133650) |
| IUPAC Name |
|---|
| 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoro-2-pyridinecarboxylic acid | Alan Wood's Pesticides |
| 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropicolinic acid | Alan Wood's Pesticides |
| XDE-848 | ChEBI |
| XR-848 | ChEBI |
| florpyrauxifène | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| florpyrauxifen | Alan Wood's Pesticides |
| US2007179060 | Patent |
| US2014274704 | Patent |
| 3096 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11450663 | Reaxys |
| CAS:943832-81-3 | Alan Wood's Pesticides |
| CAS:943832-81-3 | ChemIDplus |
| Citations |
|---|