EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12N2O3 |
| Net Charge | 0 |
| Average Mass | 172.184 |
| Monoisotopic Mass | 172.08479 |
| SMILES | C=C(/N=[N+](\[O-])CC(C)C)C(=O)O |
| InChI | InChI=1S/C7H12N2O3/c1-5(2)4-9(12)8-6(3)7(10)11/h5H,3-4H2,1-2H3,(H,10,11)/b9-8- |
| InChIKey | DTXMRELKPKEPSO-HJWRWDBZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces viridifaciens (ncbitaxon:48665) | - | PubMed (18451033) | Strain: MG456-hF10 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valanimycin (CHEBI:133621) has functional parent acrylic acid (CHEBI:18308) |
| valanimycin (CHEBI:133621) has role antimicrobial agent (CHEBI:33281) |
| valanimycin (CHEBI:133621) has role bacterial metabolite (CHEBI:76969) |
| valanimycin (CHEBI:133621) is a azoxy compound (CHEBI:37390) |
| valanimycin (CHEBI:133621) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| 2-[(2-methylpropyl)-ONN-azoxy]prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 2-(Isobutyl-(ONN)azoxy)acrylic acid | ChemIDplus |
| 2-[(2-methylpropyl)-ONN-azoxy]acrylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00017752 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21142834 | Reaxys |
| CAS:101961-60-8 | ChemIDplus |
| Citations |
|---|