EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10NO3 |
| Net Charge | -1 |
| Average Mass | 192.194 |
| Monoisotopic Mass | 192.06662 |
| SMILES | [H]C(=O)N[C@@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C10H11NO3/c12-7-11-9(10(13)14)6-8-4-2-1-3-5-8/h1-5,7,9H,6H2,(H,11,12)(H,13,14)/p-1/t9-/m0/s1 |
| InChIKey | NSTPXGARCQOSAU-VIFPVBQESA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formyl-L-phenylalaninate (CHEBI:133536) is a N-acyl-L-α-amino acid anion (CHEBI:59874) |
| N-formyl-L-phenylalaninate (CHEBI:133536) is conjugate base of N-formyl-L-phenylalanine (CHEBI:133534) |
| Incoming Relation(s) |
| N-formyl-L-phenylalanine (CHEBI:133534) is conjugate acid of N-formyl-L-phenylalaninate (CHEBI:133536) |
| IUPAC Name |
|---|
| (2S)-2-formamido-3-phenylpropanoate |
| Synonyms | Source |
|---|---|
| N-formylphenylalaninate | ChEBI |
| N-formylphenylalanine | ChEBI |
| N-formylphenylalanine(1−) | ChEBI |