EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO3 |
| Net Charge | 0 |
| Average Mass | 193.202 |
| Monoisotopic Mass | 193.07389 |
| SMILES | [H]C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C10H11NO3/c12-7-11-9(10(13)14)6-8-4-2-1-3-5-8/h1-5,7,9H,6H2,(H,11,12)(H,13,14)/t9-/m0/s1 |
| InChIKey | NSTPXGARCQOSAU-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formyl-L-phenylalanine (CHEBI:133534) is a N-acyl-L-phenylalanine (CHEBI:77673) |
| N-formyl-L-phenylalanine (CHEBI:133534) is conjugate acid of N-formyl-L-phenylalaninate (CHEBI:133536) |
| Incoming Relation(s) |
| N-formyl-L-phenylalaninate (CHEBI:133536) is conjugate base of N-formyl-L-phenylalanine (CHEBI:133534) |
| IUPAC Name |
|---|
| N-formyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| (2S)-2-formamido-3-phenyl-propanoic acid | PDBeChem |
| N-formylphenylalanine | ChEBI |
| For-Phe | ChEBI |
| N-Formyl-3-phenyl-L-alanine | ChemIDplus |
| OHC-Phe-OH | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| QPH | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2968785 | Reaxys |
| CAS:13200-85-6 | ChemIDplus |