EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O6 |
| Net Charge | 0 |
| Average Mass | 362.422 |
| Monoisotopic Mass | 362.17294 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@]23COC(=O)[C@]1(C)C[C@@H](O)C3 |
| InChI | InChI=1S/C20H26O6/c1-10-5-18-8-20(10,25)4-3-12(18)19-7-11(21)6-17(2,16(24)26-9-19)14(19)13(18)15(22)23/h11-14,21,25H,1,3-9H2,2H3,(H,22,23)/t11-,12-,13-,14-,17-,18+,19-,20+/m1/s1 |
| InChIKey | MEKWLWHELUEYHS-VGGMDSHUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) | |
| Pisum sativum (ncbitaxon:3888) | - | PubMed (8987503) | |
| Solanum lycopersicum (ncbitaxon:4081) | - | PubMed (8987503) | |
| Spinacea oleracea (ncbitaxon:3562) | leaf (BTO:0000713) | PubMed (8987503) | |
| Zea mays (ncbitaxon:4577) | pollen (BTO:0001097) | PubMed (8987503) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A98 (CHEBI:133480) has functional parent gibberellin A15 (lactone form) (CHEBI:133339) |
| gibberellin A98 (CHEBI:133480) has role plant metabolite (CHEBI:76924) |
| gibberellin A98 (CHEBI:133480) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A98 (CHEBI:133480) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| gibberellin A98 (CHEBI:133480) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A98 (CHEBI:133480) is a lactone (CHEBI:25000) |
| gibberellin A98 (CHEBI:133480) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (1R,3S,4aR,4bR,7S,9aS,10S,10aS)-3,7-dihydroxy-1-methyl-8-methylidene-14-oxododecahydro-7,9a-methano-1,4a-(methanooxymethano)benzo[a]azulene-10-carboxylic acid |
| Synonym | Source |
|---|---|
| GA98 | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| 35015194 | ChemSpider |
| C00000299 | KNApSAcK |
| HMDB0041510 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7662063 | Reaxys |
| CAS:95784-14-8 | KNApSAcK |
| Citations |
|---|