EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O4 |
| Net Charge | 0 |
| Average Mass | 330.424 |
| Monoisotopic Mass | 330.18311 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]23CCC[C@@]1(C)C(=O)OC3 |
| InChI | InChI=1S/C20H26O4/c1-11-8-20-9-12(11)4-5-13(20)19-7-3-6-18(2,17(23)24-10-19)15(19)14(20)16(21)22/h12-15H,1,3-10H2,2H3,(H,21,22)/t12-,13+,14-,15-,18-,19-,20+/m1/s1 |
| InChIKey | MXCOJKLBLFWFNI-CXXOJBQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS118) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS117) | ||
| seed (BTO:0001226) | PubMed (25369450) | ||
| Penicillium sp. MH7 (ncbitaxon:647391) | - | PubMed (20134253) | |
| Ochroconis tshawytschae (ncbitaxon:262132) | - | PubMed (19597313) | |
| Cladosporium sp. MH6 (ncbitaxon:647389) | - | PubMed (20943499) | |
| Chrysosporium pseudomerdarium (ncbitaxon:465709) | - | PubMed (19763416) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A15 (lactone form) (CHEBI:133339) has role bacterial metabolite (CHEBI:76969) |
| gibberellin A15 (lactone form) (CHEBI:133339) has role fungal metabolite (CHEBI:76946) |
| gibberellin A15 (lactone form) (CHEBI:133339) has role plant metabolite (CHEBI:76924) |
| gibberellin A15 (lactone form) (CHEBI:133339) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A15 (lactone form) (CHEBI:133339) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A15 (lactone form) (CHEBI:133339) is a lactone (CHEBI:25000) |
| Incoming Relation(s) |
| gibberellin A98 (CHEBI:133480) has functional parent gibberellin A15 (lactone form) (CHEBI:133339) |
| IUPAC Name |
|---|
| (1R,4aR,4bR,7R,9aR,10S,10aS)-1-methyl-8-methylidene-14-oxododecahydro-7,9a-methano-1,4a-(methanooxymethano)benzo[a]azulene-10-carboxylic acid |
| Synonyms | Source |
|---|---|
| Gibberellin A15 | KEGG COMPOUND |
| GA15 | ChEBI |
| gibberellin A15 (closed lactone form) | MetaCyc |
| GA15 (closed lactone form) | MetaCyc |
| Citations |
|---|