EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9N2O2 |
| Net Charge | +1 |
| Average Mass | 129.139 |
| Monoisotopic Mass | 129.06585 |
| SMILES | [NH3+]C1CCC(=O)NC1=O |
| InChI | InChI=1S/C5H8N2O2/c6-3-1-2-4(8)7-5(3)9/h3H,1-2,6H2,(H,7,8,9)/p+1 |
| InChIKey | NPWMTBZSRRLQNJ-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyroglutamine(1+) (CHEBI:133471) is a primary ammonium ion (CHEBI:65296) |
| pyroglutamine(1+) (CHEBI:133471) is conjugate acid of pyroglutamine (CHEBI:133469) |
| Incoming Relation(s) |
| pyroglutamine (CHEBI:133469) is conjugate base of pyroglutamine(1+) (CHEBI:133471) |
| IUPAC Name |
|---|
| 2,6-dioxopiperidin-3-aminium |
| Synonyms | Source |
|---|---|
| α-aminoglutarimide(1+) | ChEBI |
| α-azaniumylglutarimide | ChEBI |
| 3-azaniumyl-1,6-dioxopiperidine | ChEBI |