EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8N2O2 |
| Net Charge | 0 |
| Average Mass | 128.131 |
| Monoisotopic Mass | 128.05858 |
| SMILES | NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C5H8N2O2/c6-3-1-2-4(8)7-5(3)9/h3H,1-2,6H2,(H,7,8,9) |
| InChIKey | NPWMTBZSRRLQNJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyroglutamine (CHEBI:133469) has functional parent piperidine-2,6-dione (CHEBI:5435) |
| pyroglutamine (CHEBI:133469) is a dicarboximide (CHEBI:35356) |
| pyroglutamine (CHEBI:133469) is a piperidones (CHEBI:48589) |
| pyroglutamine (CHEBI:133469) is a primary amino compound (CHEBI:50994) |
| pyroglutamine (CHEBI:133469) is conjugate base of pyroglutamine(1+) (CHEBI:133471) |
| Incoming Relation(s) |
| (S)-3-aminopiperidine-2,6-dione (CHEBI:231892) is a pyroglutamine (CHEBI:133469) |
| pyroglutamine(1+) (CHEBI:133471) is conjugate acid of pyroglutamine (CHEBI:133469) |
| IUPAC Name |
|---|
| 3-aminopiperidine-2,6-dione |
| Synonyms | Source |
|---|---|
| 3-amino-1,6-dioxopiperidine | ChEBI |
| 3-Amino-2,6-piperidinedione | ChemIDplus |
| 3-Aminoglutarimide | ChemIDplus |
| alpha-Aminoglutarimide | ChemIDplus |
| α-aminoglutarimide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:81982 | Reaxys |
| CAS:2353-44-8 | ChemIDplus |