EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27O5 |
| Net Charge | -1 |
| Average Mass | 347.431 |
| Monoisotopic Mass | 347.18640 |
| SMILES | O=CCCCC/C=C\CC(=O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)[O-] |
| InChI | InChI=1S/C20H28O5/c21-17-10-6-2-1-3-7-12-18(22)13-8-4-5-9-14-19(23)15-11-16-20(24)25/h3-5,7-9,13-14,17,19,23H,1-2,6,10-12,15-16H2,(H,24,25)/p-1/b5-4+,7-3-,13-8+,14-9-/t19-/m1/s1 |
| InChIKey | CPTWPKCLDUXOKW-RBQYXHKQSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12,20-dioxoleukotriene B4(1−) (CHEBI:133436) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| 12,20-dioxoleukotriene B4(1−) (CHEBI:133436) is a leukotriene anion (CHEBI:62942) |
| 12,20-dioxoleukotriene B4(1−) (CHEBI:133436) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| 12,20-dioxoleukotriene B4(1−) (CHEBI:133436) is a ω-oxo fatty acid anion (CHEBI:76309) |
| 12,20-dioxoleukotriene B4(1−) (CHEBI:133436) is conjugate base of 12,20-dioxoleukotriene B4 (CHEBI:134520) |
| Incoming Relation(s) |
| 12,20-dioxoleukotriene B4 (CHEBI:134520) is conjugate acid of 12,20-dioxoleukotriene B4(1−) (CHEBI:133436) |
| IUPAC Name |
|---|
| (5S,6Z,8E,10E,14Z)-5-hydroxy-12,20-dioxoicosa-6,8,10,14-tetraenoate |
| Synonyms | Source |
|---|---|
| 12,20-dioxo-leukotriene B4(1−) | ChEBI |
| 12,20-dioxo-LTB4(1−) | ChEBI |