EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O5 |
| Net Charge | 0 |
| Average Mass | 196.158 |
| Monoisotopic Mass | 196.03717 |
| SMILES | O=C(O)C=CC1=CC(=O)C(O)=CC1O |
| InChI | InChI=1S/C9H8O5/c10-6-4-8(12)7(11)3-5(6)1-2-9(13)14/h1-4,6,10,12H,(H,13,14) |
| InChIKey | ZDUUJTSRZWILGW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | |||
| - | MetaboLights (MTBLS118) | ||
| - | MetaboLights (MTBLS117) | ||
| - | PubMed (25369450) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid (CHEBI:133314) has functional parent acrylic acid (CHEBI:18308) |
| 3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid (CHEBI:133314) has role plant metabolite (CHEBI:76924) |
| 3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid (CHEBI:133314) is a cyclohexenones (CHEBI:48953) |
| 3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid (CHEBI:133314) is a enol (CHEBI:33823) |
| 3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid (CHEBI:133314) is a enone (CHEBI:51689) |
| 3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid (CHEBI:133314) is a secondary alcohol (CHEBI:35681) |
| 3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)acrylic acid (CHEBI:133314) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| 3-(4,6-dihydroxy-3-oxocyclohexa-1,4-dien-1-yl)prop-2-enoic acid |
| Synonym | Source |
|---|---|
| 3-(2-propenoic acid)-4,6-hydroxycyclohexa-2,5-dienone | ChEBI |