EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O8 |
| Net Charge | 0 |
| Average Mass | 368.342 |
| Monoisotopic Mass | 368.12197 |
| SMILES | CN1C(=O)[C@H](O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)C[C@H]1c1cccnc1 |
| InChI | InChI=1S/C16H20N2O8/c1-18-8(7-3-2-4-17-6-7)5-9(14(18)22)25-16-12(21)10(19)11(20)13(26-16)15(23)24/h2-4,6,8-13,16,19-21H,5H2,1H3,(H,23,24)/t8-,9+,10-,11-,12+,13-,16+/m0/s1 |
| InChIKey | WALNNKZUGHYSCT-MGKNELHOSA-N |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-3-hydroxycotinine β-D-glucuronide (CHEBI:133206) has functional parent trans-3-hydroxycotinine (CHEBI:71182) |
| trans-3-hydroxycotinine β-D-glucuronide (CHEBI:133206) has role human urinary metabolite (CHEBI:84087) |
| trans-3-hydroxycotinine β-D-glucuronide (CHEBI:133206) has role human xenobiotic metabolite (CHEBI:76967) |
| trans-3-hydroxycotinine β-D-glucuronide (CHEBI:133206) is a pyridines (CHEBI:26421) |
| trans-3-hydroxycotinine β-D-glucuronide (CHEBI:133206) is a pyrrolidin-2-ones (CHEBI:74223) |
| trans-3-hydroxycotinine β-D-glucuronide (CHEBI:133206) is a β-D-glucosiduronic acid (CHEBI:15341) |
| trans-3-hydroxycotinine β-D-glucuronide (CHEBI:133206) is conjugate acid of trans-3-hydroxycotinine β-D-glucuronide(1−) (CHEBI:133205) |
| Incoming Relation(s) |
| trans-3-hydroxycotinine β-D-glucuronide(1−) (CHEBI:133205) is conjugate base of trans-3-hydroxycotinine β-D-glucuronide (CHEBI:133206) |
| IUPAC Name |
|---|
| (3R,5S)-1-methyl-2-oxo-5-(pyridin-3-yl)pyrrolidin-3-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| 3-hydroxycotinine glucuronide | ChEBI |
| 3'-Hydroxycotnine-glucuronide | HMDB |
| trans-3-Hydroxycotinine glucuronide | HMDB |
| 3HC-Gluc | HMDB |
| trans-3'-Hydroxycotinine-O-glucuronide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001204 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21859433 | Reaxys |
| CAS:132929-88-5 | ChemIDplus |
| Citations |
|---|