EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N2O8 |
| Net Charge | -1 |
| Average Mass | 367.334 |
| Monoisotopic Mass | 367.11469 |
| SMILES | CN1C(=O)[C@H](O[C@@H]2O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)C[C@H]1c1cccnc1 |
| InChI | InChI=1S/C16H20N2O8/c1-18-8(7-3-2-4-17-6-7)5-9(14(18)22)25-16-12(21)10(19)11(20)13(26-16)15(23)24/h2-4,6,8-13,16,19-21H,5H2,1H3,(H,23,24)/p-1/t8-,9+,10-,11-,12+,13-,16+/m0/s1 |
| InChIKey | WALNNKZUGHYSCT-MGKNELHOSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-3-hydroxycotinine β-D-glucuronide(1−) (CHEBI:133205) is a carbohydrate acid derivative anion (CHEBI:63551) |
| trans-3-hydroxycotinine β-D-glucuronide(1−) (CHEBI:133205) is conjugate base of trans-3-hydroxycotinine β-D-glucuronide (CHEBI:133206) |
| Incoming Relation(s) |
| trans-3-hydroxycotinine β-D-glucuronide (CHEBI:133206) is conjugate acid of trans-3-hydroxycotinine β-D-glucuronide(1−) (CHEBI:133205) |
| IUPAC Name |
|---|
| (3R,5S)-1-methyl-2-oxo-5-(pyridin-3-yl)pyrrolidin-3-yl β-D-glucopyranosiduronate |
| Synonyms | Source |
|---|---|
| 3-hydroxycotinine glucuronide(1−) | ChEBI |
| 3-hydroxycotinine glucuronide | ChEBI |