EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O4 |
| Net Charge | -2 |
| Average Mass | 234.251 |
| Monoisotopic Mass | 234.09031 |
| SMILES | CC(Cc1ccc(C(C)C(=O)[O-])cc1)C(=O)[O-] |
| InChI | InChI=1S/C13H16O4/c1-8(12(14)15)7-10-3-5-11(6-4-10)9(2)13(16)17/h3-6,8-9H,7H2,1-2H3,(H,14,15)(H,16,17)/p-2 |
| InChIKey | DIVLBIVDYADZPL-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (9094205) |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carboxyibuprofen(2−) (CHEBI:133200) has role drug metabolite (CHEBI:49103) |
| carboxyibuprofen(2−) (CHEBI:133200) is a dicarboxylic acid dianion (CHEBI:28965) |
| carboxyibuprofen(2−) (CHEBI:133200) is conjugate base of carboxyibuprofen (CHEBI:133199) |
| Incoming Relation(s) |
| carboxyibuprofen (CHEBI:133199) is conjugate acid of carboxyibuprofen(2−) (CHEBI:133200) |
| IUPAC Name |
|---|
| 3-[4-(1-carboxylatoethyl)phenyl]-2-methylpropanoate |
| Synonym | Source |
|---|---|
| carboxyibuprofen dianion | ChEBI |