EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O4 |
| Net Charge | 0 |
| Average Mass | 236.267 |
| Monoisotopic Mass | 236.10486 |
| SMILES | CC(Cc1ccc(C(C)C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C13H16O4/c1-8(12(14)15)7-10-3-5-11(6-4-10)9(2)13(16)17/h3-6,8-9H,7H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | DIVLBIVDYADZPL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (9094205) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carboxyibuprofen (CHEBI:133199) has functional parent ibuprofen (CHEBI:5855) |
| carboxyibuprofen (CHEBI:133199) has role drug metabolite (CHEBI:49103) |
| carboxyibuprofen (CHEBI:133199) is a dicarboxylic acid (CHEBI:35692) |
| carboxyibuprofen (CHEBI:133199) is conjugate acid of carboxyibuprofen anion (CHEBI:133198) |
| carboxyibuprofen (CHEBI:133199) is conjugate acid of carboxyibuprofen(2−) (CHEBI:133200) |
| Incoming Relation(s) |
| carboxyibuprofen anion (CHEBI:133198) is conjugate base of carboxyibuprofen (CHEBI:133199) |
| carboxyibuprofen(2−) (CHEBI:133200) is conjugate base of carboxyibuprofen (CHEBI:133199) |
| IUPAC Name |
|---|
| 3-[4-(1-carboxyethyl)phenyl]-2-methylpropanoic acid |
| Synonyms | Source |
|---|---|
| 2,4'-(2-Carboxypropyl)phenylpropionic acid | ChemIDplus |
| 2-(4-(2-Carboxypropyl)phenyl)propionic acid | ChemIDplus |
| Carboxy-ibuprofen | HMDB |
| Ibuprofen COOH | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060564 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5951324 | Reaxys |
| CAS:15935-54-3 | ChemIDplus |
| Citations |
|---|