EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13ClNO3.K |
| Net Charge | 0 |
| Average Mass | 329.824 |
| Monoisotopic Mass | 329.02210 |
| SMILES | CCn1c(C)cc(=O)c(C(=O)[O-])c1-c1ccc(Cl)cc1.[K+] |
| InChI | InChI=1S/C15H14ClNO3.K/c1-3-17-9(2)8-12(18)13(15(19)20)14(17)10-4-6-11(16)7-5-10;/h4-8H,3H2,1-2H3,(H,19,20);/q;+1/p-1 |
| InChIKey | IUUMSKQPWAMVQI-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | chemical hybridisation agent A plant growth regulator that produces male sterility in plants by preventing pollen development, pollen shed, or pollen viability. This makes the plant adaptable to hybridization without the need for laborious hand pollination. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| karetazan-potassium (CHEBI:133129) has part karetazan(1−) (CHEBI:133128) |
| karetazan-potassium (CHEBI:133129) has role chemical hybridisation agent (CHEBI:133106) |
| karetazan-potassium (CHEBI:133129) is a potassium salt (CHEBI:26218) |
| IUPAC Name |
|---|
| potassium 2-(4-chlorophenyl)-1-ethyl-6-methyl-4-oxo-1,4-dihydropyridine-3-carboxylate |
| Synonyms | Source |
|---|---|
| potassium 2-(4-chlorophenyl)-1-ethyl-1,4-dihydro-6-methyl-4-oxo-3-pyridinecarboxylate | Alan Wood's Pesticides |
| potassium 2-(4-chlorophenyl)-1-ethyl-1,4-dihydro-6-methyl-4-oxonicotinate | Alan Wood's Pesticides |
| potassium 2-(p-chlorophenyl)-1-ethyl-1,4-dihydro-6-methyl-4-oxo-3-pyridinecarboxylate | Alan Wood's Pesticides |
| potassium 2-(p-chlorophenyl)-1-ethyl-1,4-dihydro-6-methyl-4-oxonicotinate | Alan Wood's Pesticides |
| potassium 2-(p-chlorophenyl)-1-ethyl-6-methyl-4-oxo-1,4-dihydropyridine-3-carboxylate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| derivatives/karetazan-potassium | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:81052-29-1 | Alan Wood's Pesticides |
| CAS:81052-29-1 | ChemIDplus |