EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13ClNO3 |
| Net Charge | -1 |
| Average Mass | 290.726 |
| Monoisotopic Mass | 290.05894 |
| SMILES | CCn1c(C)cc(=O)c(C(=O)[O-])c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClNO3/c1-3-17-9(2)8-12(18)13(15(19)20)14(17)10-4-6-11(16)7-5-10/h4-8H,3H2,1-2H3,(H,19,20)/p-1 |
| InChIKey | GQFJDWYHPRLNHR-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| karetazan(1−) (CHEBI:133128) is a monocarboxylic acid anion (CHEBI:35757) |
| karetazan(1−) (CHEBI:133128) is conjugate base of karetazan (CHEBI:133122) |
| Incoming Relation(s) |
| karetazan-potassium (CHEBI:133129) has part karetazan(1−) (CHEBI:133128) |
| karetazan (CHEBI:133122) is conjugate acid of karetazan(1−) (CHEBI:133128) |
| IUPAC Name |
|---|
| 2-(4-chlorophenyl)-1-ethyl-6-methyl-4-oxo-1,4-dihydropyridine-3-carboxylate |
| Synonyms | Source |
|---|---|
| 1-ethyl-6-methyl-2-(4-chlorophenyl)-4-oxonicotinate | ChEBI |
| 2-(4-chlorophenyl)-1-ethyl-1,4-dihydro-6-methyl-4-oxo-3-pyridinecarboxylate | ChEBI |
| 2-(4-chlorophenyl)-1-ethyl-1,4-dihydro-6-methyl-4-oxonicotinate | ChEBI |