EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4S |
| Net Charge | 0 |
| Average Mass | 214.242 |
| Monoisotopic Mass | 214.02998 |
| SMILES | C=CCc1ccc(OS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H10O4S/c1-2-3-8-4-6-9(7-5-8)13-14(10,11)12/h2,4-7H,1,3H2,(H,10,11,12) |
| InChIKey | KFDHKOFCRYUXLA-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chavicol hydrogen sulfate (CHEBI:133096) has functional parent chavicol (CHEBI:50158) |
| chavicol hydrogen sulfate (CHEBI:133096) is a aryl sulfate (CHEBI:37919) |
| chavicol hydrogen sulfate (CHEBI:133096) is a olefinic compound (CHEBI:78840) |
| chavicol hydrogen sulfate (CHEBI:133096) is conjugate acid of chavicol sulfate (CHEBI:133097) |
| Incoming Relation(s) |
| chavicol sulfate (CHEBI:133097) is conjugate base of chavicol hydrogen sulfate (CHEBI:133096) |
| IUPAC Name |
|---|
| 4-(prop-2-en-1-yl)phenyl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| 4-allylphenol sulfate | ChEBI |
| 4-allylphenyl hydrogen sulfate | ChEBI |
| chavicol sulfate | ChEBI |
| p-allylphenyl hydrogen sulfate | ChEBI |
| p-allylphenyl sulfate | ChEBI |