EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N2O5 |
| Net Charge | -1 |
| Average Mass | 231.228 |
| Monoisotopic Mass | 231.09865 |
| SMILES | CCC(NC(=O)CCC([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H16N2O5/c1-2-6(9(15)16)11-7(12)4-3-5(10)8(13)14/h5-6H,2-4,10H2,1H3,(H,11,12)(H,13,14)(H,15,16)/p-1 |
| InChIKey | FUZOZPRKGAXGOB-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Abu(1−) (CHEBI:133093) is a peptide anion (CHEBI:60334) |
| γ-Glu-Abu(1−) (CHEBI:133093) is conjugate base of γ-Glu-Abu (CHEBI:133092) |
| Incoming Relation(s) |
| γ-Glu-Abu (CHEBI:133092) is conjugate acid of γ-Glu-Abu(1−) (CHEBI:133093) |
| IUPAC Name |
|---|
| 2-azaniumyl-5-[(1-carboxylatopropyl)amino]-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| gamma-glutamyl-2-aminobutyrate | ChEBI |
| γ-glutamyl-2-aminobutyrate | ChEBI |