EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O5 |
| Net Charge | 0 |
| Average Mass | 232.236 |
| Monoisotopic Mass | 232.10592 |
| SMILES | CCC(NC(=O)CCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O5/c1-2-6(9(15)16)11-7(12)4-3-5(10)8(13)14/h5-6H,2-4,10H2,1H3,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | FUZOZPRKGAXGOB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Abu (CHEBI:133092) is a dipeptide (CHEBI:46761) |
| γ-Glu-Abu (CHEBI:133092) is conjugate acid of γ-Glu-Abu(1−) (CHEBI:133093) |
| Incoming Relation(s) |
| γ-Glu-Abu(1−) (CHEBI:133093) is conjugate base of γ-Glu-Abu (CHEBI:133092) |
| IUPAC Name |
|---|
| N-(1-carboxypropyl)glutamine |
| Synonym | Source |
|---|---|
| γ-glutamyl-2-aminobutyric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25853400 | Reaxys |