EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N4O5 |
| Net Charge | -1 |
| Average Mass | 283.264 |
| Monoisotopic Mass | 283.10479 |
| SMILES | [NH3+][C@@H](CCC(=O)N[C@@H](Cc1cncn1)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C11H16N4O5/c12-7(10(17)18)1-2-9(16)15-8(11(19)20)3-6-4-13-5-14-6/h4-5,7-8H,1-3,12H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)/p-1/t7-,8-/m0/s1 |
| InChIKey | PXVCMZCJAUJLJP-YUMQZZPRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-His(1−) (CHEBI:133033) is a peptide anion (CHEBI:60334) |
| γ-Glu-His(1−) (CHEBI:133033) is conjugate base of γ-Glu-His (CHEBI:133032) |
| Incoming Relation(s) |
| γ-Glu-His (CHEBI:133032) is conjugate acid of γ-Glu-His(1−) (CHEBI:133033) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-{[(1S)-1-carboxylato-2-(1H-imidazol-4-yl)ethyl]amino}-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| γ-glutamylhistidine(1−) | ChEBI |
| L-γ-Glu-L-His(1−) | ChEBI |
| L-γ-glutamyl-L-histidine(1−) | ChEBI |