EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N4O5 |
| Net Charge | 0 |
| Average Mass | 284.272 |
| Monoisotopic Mass | 284.11207 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](Cc1cncn1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H16N4O5/c12-7(10(17)18)1-2-9(16)15-8(11(19)20)3-6-4-13-5-14-6/h4-5,7-8H,1-3,12H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)/t7-,8-/m0/s1 |
| InChIKey | PXVCMZCJAUJLJP-YUMQZZPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | - | PubMed (932730) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-His (CHEBI:133032) has role mammalian metabolite (CHEBI:75768) |
| γ-Glu-His (CHEBI:133032) is a glutamyl-L-amino acid (CHEBI:24323) |
| γ-Glu-His (CHEBI:133032) is conjugate acid of γ-Glu-His(1−) (CHEBI:133033) |
| Incoming Relation(s) |
| γ-Glu-His(1−) (CHEBI:133033) is conjugate base of γ-Glu-His (CHEBI:133032) |
| IUPAC Name |
|---|
| L-γ-glutamyl-L-histidine |
| Synonyms | Source |
|---|---|
| L-γ-Glu-L-His | ChEBI |
| γ-glutamylhistidine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:932381 | Reaxys |
| Citations |
|---|