EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H50ClN7O7S |
| Net Charge | 0 |
| Average Mass | 868.457 |
| Monoisotopic Mass | 867.31810 |
| SMILES | CC1(C)CCC(CN2CCN(c3ccc(C(=O)NS(=O)(=O)c4ccc(NCC5CCOCC5)c([N+](=O)[O-])c4)c(Oc4cnc5nccc5c4)c3)CC2)=C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C45H50ClN7O7S/c1-45(2)15-11-33(39(26-45)31-3-5-34(46)6-4-31)29-51-17-19-52(20-18-51)35-7-9-38(42(24-35)60-36-23-32-12-16-47-43(32)49-28-36)44(54)50-61(57,58)37-8-10-40(41(25-37)53(55)56)48-27-30-13-21-59-22-14-30/h3-10,12,16,23-25,28,30,48H,11,13-15,17-22,26-27,29H2,1-2H3,(H,47,49)(H,50,54) |
| InChIKey | LQBVNQSMGBZMKD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. B-cell lymphoma 2 inhibitor Any inhibitor of B-cell lymphoma 2 protein. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| venetoclax (CHEBI:133021) has role antineoplastic agent (CHEBI:35610) |
| venetoclax (CHEBI:133021) has role apoptosis inducer (CHEBI:68495) |
| venetoclax (CHEBI:133021) has role B-cell lymphoma 2 inhibitor (CHEBI:133022) |
| venetoclax (CHEBI:133021) is a C-nitro compound (CHEBI:35716) |
| venetoclax (CHEBI:133021) is a N-alkylpiperazine (CHEBI:46845) |
| venetoclax (CHEBI:133021) is a N-arylpiperazine (CHEBI:46848) |
| venetoclax (CHEBI:133021) is a N-sulfonylcarboxamide (CHEBI:90852) |
| venetoclax (CHEBI:133021) is a aromatic ether (CHEBI:35618) |
| venetoclax (CHEBI:133021) is a monochlorobenzenes (CHEBI:83403) |
| venetoclax (CHEBI:133021) is a oxanes (CHEBI:46942) |
| venetoclax (CHEBI:133021) is a pyrrolopyridine (CHEBI:46771) |
| IUPAC Name |
|---|
| 4-{4-[(4'-chloro-5,5-dimethyl[3,4,5,6-tetrahydro[1,1'-biphenyl]]-2-yl)methyl]piperazin-1-yl}-N-(3-nitro-4-{[(oxan-4-yl)methyl]amino}benzene-1-sulfonyl)-2-[(1H-pyrrolo[2,3-b]pyridin-5-yl)oxy]benzamide |
| INN | Source |
|---|---|
| venetoclax | KEGG DRUG |
| Synonyms | Source |
|---|---|
| ABT 199 | ChemIDplus |
| GDC 0199 | ChemIDplus |
| ABT-199 | ChemIDplus |
| ABT199 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Venclexta | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D10679 | KEGG DRUG |
| Venetoclax | Wikipedia |
| 5133 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20908256 | Reaxys |
| CAS:1257044-40-8 | KEGG DRUG |
| CAS:1257044-40-8 | ChemIDplus |
| Citations |
|---|