EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O3 |
| Net Charge | -1 |
| Average Mass | 131.151 |
| Monoisotopic Mass | 131.07137 |
| SMILES | CC(O)CCCC(=O)[O-] |
| InChI | InChI=1S/C6H12O3/c1-5(7)3-2-4-6(8)9/h5,7H,2-4H2,1H3,(H,8,9)/p-1 |
| InChIKey | YDCRNMJQROAWFT-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxyhexanoate (CHEBI:132985) is a (ω−1)-hydroxy fatty acid anion (CHEBI:84497) |
| 5-hydroxyhexanoate (CHEBI:132985) is a hydroxy saturated fatty acid anion (CHEBI:131872) |
| 5-hydroxyhexanoate (CHEBI:132985) is a medium-chain fatty acid anion (CHEBI:59558) |
| 5-hydroxyhexanoate (CHEBI:132985) is conjugate base of 5-hydroxyhexanoic acid (CHEBI:131434) |
| Incoming Relation(s) |
| 5-hydroxyhexanoic acid (CHEBI:131434) is conjugate acid of 5-hydroxyhexanoate (CHEBI:132985) |
| IUPAC Name |
|---|
| 5-hydroxyhexanoate |
| Synonym | Source |
|---|---|
| 5-hydroxycaproate | ChEBI |