EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:131434 - 5-hydroxyhexanoic acid
| Formula | C6H12O3 |
| Net Charge | 0 |
| Average Mass | 132.159 |
| Monoisotopic Mass | 132.07864 |
| SMILES | CC(O)CCCC(=O)O |
| InChI | InChI=1S/C6H12O3/c1-5(7)3-2-4-6(8)9/h5,7H,2-4H2,1H3,(H,8,9) |
| InChIKey | YDCRNMJQROAWFT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (6897376) | ||
| - | MetaboLights (MTBLS298) | ||
| - | PubMed (26839171) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxyhexanoic acid (CHEBI:131434) has functional parent hexanoic acid (CHEBI:30776) |
| 5-hydroxyhexanoic acid (CHEBI:131434) has role human urinary metabolite (CHEBI:84087) |
| 5-hydroxyhexanoic acid (CHEBI:131434) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| 5-hydroxyhexanoic acid (CHEBI:131434) is a medium-chain fatty acid (CHEBI:59554) |
| 5-hydroxyhexanoic acid (CHEBI:131434) is conjugate acid of 5-hydroxyhexanoate (CHEBI:132985) |
| Incoming Relation(s) |
| 5-hydroxyhexanoate (CHEBI:132985) is conjugate base of 5-hydroxyhexanoic acid (CHEBI:131434) |
| IUPAC Name |
|---|
| 5-hydroxyhexanoic acid |
| Synonyms | Source |
|---|---|
| 5-hydroxycaproic acid | ChEBI |
| 5-OH-caproic acid | HMDB |
| 5-hydroxy caproic acid | LIPID MAPS |
| 5-hydroxy-hexanoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| 149280 | ChemSpider |
| HMDB0000525 | HMDB |
| LMFA01050014 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1749065 | Reaxys |
| CAS:44843-89-2 | ChemIDplus |
| Citations |
|---|