EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O7 |
| Net Charge | 0 |
| Average Mass | 346.335 |
| Monoisotopic Mass | 346.10525 |
| SMILES | COc1ccc(CC2COc3cc(O)c(OC)c(O)c3C2=O)cc1O |
| InChI | InChI=1S/C18H18O7/c1-23-13-4-3-9(6-11(13)19)5-10-8-25-14-7-12(20)18(24-2)17(22)15(14)16(10)21/h3-4,6-7,10,19-20,22H,5,8H2,1-2H3 |
| InChIKey | DSTDMPAJBBOFCE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Merwilla plumbea (ncbitaxon:208511) | - | PubMed (15755657) | |
| Muscari armeniacum (ncbitaxon:156613) | - | Article (Phytochemistry 1987, 26, 285-290) | |
| Cremastra appendiculata (ncbitaxon:459596) | bulb (BTO:0000159) | PubMed (14994197) | |
| Merwilla natalensis (ncbitaxon:205725) | - | Article (Phytochemistry 1999, 51, 943-946) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cremastranone (CHEBI:132956) has role angiogenesis modulating agent (CHEBI:50926) |
| cremastranone (CHEBI:132956) has role plant metabolite (CHEBI:76924) |
| cremastranone (CHEBI:132956) is a aromatic ether (CHEBI:35618) |
| cremastranone (CHEBI:132956) is a homoisoflavonoid (CHEBI:86008) |
| cremastranone (CHEBI:132956) is a polyphenol (CHEBI:26195) |
| Incoming Relation(s) |
| SH-11037 (CHEBI:132925) has functional parent cremastranone (CHEBI:132956) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-(3-hydroxy-4-methoxybenzyl)-6-methoxy-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5,7-dihydroxy-3-(3-hydroxy-4-methoxybenzyl)-6-methoxychroman-4-one | ChEBI |
| 3-(3-hydroxy-4-methoxybenzyl)-5,7-dihydroxy-6-methoxychroman-4-one | ChEBI |
| 5,7-dihydroxy-6-methoxy-3-(3'-hydroxy-4'-methoxybenzyl)-4-chromanone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5452227 | Reaxys |
| Citations |
|---|