EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H39NO10 |
| Net Charge | 0 |
| Average Mass | 621.683 |
| Monoisotopic Mass | 621.25740 |
| SMILES | COc1ccc(CC2COc3cc(OC)c(OC)c(OC)c3C2=O)cc1OC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H39NO10/c1-34(2,3)45-33(38)35-23(16-20-11-9-8-10-12-20)32(37)44-25-17-21(13-14-24(25)39-4)15-22-19-43-26-18-27(40-5)30(41-6)31(42-7)28(26)29(22)36/h8-14,17-18,22-23H,15-16,19H2,1-7H3,(H,35,38)/t22?,23-/m0/s1 |
| InChIKey | WNDLJGVBWVLFKK-WCSIJFPASA-N |
| Roles Classification |
|---|
| Applications: | pharmaceutical Any substance introduced into a living organism with therapeutic or diagnostic purpose. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SH-11037 (CHEBI:132925) has functional parent cremastranone (CHEBI:132956) |
| SH-11037 (CHEBI:132925) has role angiogenesis inhibitor (CHEBI:48422) |
| SH-11037 (CHEBI:132925) has role pharmaceutical (CHEBI:52217) |
| SH-11037 (CHEBI:132925) is a L-phenylalanine derivative (CHEBI:84144) |
| SH-11037 (CHEBI:132925) is a aromatic ether (CHEBI:35618) |
| SH-11037 (CHEBI:132925) is a carbamate ester (CHEBI:23003) |
| SH-11037 (CHEBI:132925) is a homoisoflavonoid (CHEBI:86008) |
| SH-11037 (CHEBI:132925) is a semisynthetic derivative (CHEBI:72588) |
| IUPAC Name |
|---|
| 2-methoxy-5-[(5,6,7-trimethoxy-4-oxo-3,4-dihydro-2H-chromen-3-yl)methyl]phenyl N-(tert-butoxycarbonyl)-L-phenylalaninate |
| Synonym | Source |
|---|---|
| 2-methoxy-5-[(5,6,7-trimethoxy-4-oxo-3,4-dihydro-2H-chromen-3-yl)methyl]phenyl (2S)-2-[(tert-butoxycarbonyl)amino]-3-phenylpropanoate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27554585 | Reaxys |
| Citations |
|---|