EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CCCCC[C@@H]1O[C@H]1/C=C/[C@@H](O)C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-3-9-13-18-19(24-18)16-15-17(21)12-10-7-5-4-6-8-11-14-20(22)23/h4,6-7,10,15-19,21H,2-3,5,8-9,11-14H2,1H3,(H,22,23)/b6-4-,10-7-,16-15+/t17-,18-,19-/m0/s1 |
| InChIKey | WLMZMBKVRPUYIG-CHDPIHKSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21046276) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11(S)-hydroxy-14(S),15(S)-hepoxilin A3 (CHEBI:132886) has role human xenobiotic metabolite (CHEBI:76967) |
| 11(S)-hydroxy-14(S),15(S)-hepoxilin A3 (CHEBI:132886) is a epoxy fatty acid (CHEBI:61498) |
| 11(S)-hydroxy-14(S),15(S)-hepoxilin A3 (CHEBI:132886) is a hepoxilin (CHEBI:36200) |
| 11(S)-hydroxy-14(S),15(S)-hepoxilin A3 (CHEBI:132886) is a hydroxy fatty acid (CHEBI:24654) |
| 11(S)-hydroxy-14(S),15(S)-hepoxilin A3 (CHEBI:132886) is a long-chain fatty acid (CHEBI:15904) |
| 11(S)-hydroxy-14(S),15(S)-hepoxilin A3 (CHEBI:132886) is a trienoic fatty acid (CHEBI:73155) |
| 11(S)-hydroxy-14(S),15(S)-hepoxilin A3 (CHEBI:132886) is conjugate acid of 11(S)-hydroxy-14(S),15(S)-hepoxilin A3(1−) (CHEBI:132201) |
| Incoming Relation(s) |
| 11(S)-hydroxy-14(S),15(S)-hepoxilin A3(1−) (CHEBI:132201) is conjugate base of 11(S)-hydroxy-14(S),15(S)-hepoxilin A3 (CHEBI:132886) |
| IUPAC Name |
|---|
| (5Z,8Z,11S,12E)-11-hydroxy-13-[(2S,3S)-3-pentyloxiran-2-yl]trideca-5,8,12-trienoic acid |
| Synonyms | Source |
|---|---|
| 11(S)-14,15-hepoxilin A3 | ChEBI |
| 11(S)-14,15-HxA3 | ChEBI |
| 11(S)-hydroxy-14(S),15(S)-epoxy-5(Z),8(Z),12(E)-eicosatrienoic acid | ChEBI |
| 11(S)-hydroxy-14(S),15(S)-epoxy-5(Z),8(Z),12(E)-icosatrienoic acid | ChEBI |
| 14(S),15(S)-hepoxilin A3 | ChEBI |
| 14(S),15(S)-HxA3 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22075237 | Reaxys |
| Citations |
|---|