EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O4 |
| Net Charge | -1 |
| Average Mass | 335.464 |
| Monoisotopic Mass | 335.22278 |
| SMILES | CCCCC[C@@H]1O[C@H]1/C=C/[C@@H](O)C/C=C\C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H32O4/c1-2-3-9-13-18-19(24-18)16-15-17(21)12-10-7-5-4-6-8-11-14-20(22)23/h4,6-7,10,15-19,21H,2-3,5,8-9,11-14H2,1H3,(H,22,23)/p-1/b6-4-,10-7-,16-15+/t17-,18-,19-/m0/s1 |
| InChIKey | WLMZMBKVRPUYIG-CHDPIHKSSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11(S)-hydroxy-14(S),15(S)-hepoxilin A3(1−) (CHEBI:132201) is a hepoxilin anion (CHEBI:62938) |
| 11(S)-hydroxy-14(S),15(S)-hepoxilin A3(1−) (CHEBI:132201) is conjugate base of 11(S)-hydroxy-14(S),15(S)-hepoxilin A3 (CHEBI:132886) |
| Incoming Relation(s) |
| 11(S)-hydroxy-14(S),15(S)-hepoxilin A3 (CHEBI:132886) is conjugate acid of 11(S)-hydroxy-14(S),15(S)-hepoxilin A3(1−) (CHEBI:132201) |
| IUPAC Name |
|---|
| (5Z,8Z,11S,12E)-11-hydroxy-13-[(2S,3S)-3-pentyloxiran-2-yl]trideca-5,8,12-trienoate |
| Synonyms | Source |
|---|---|
| 14(S),15(S)-HxA3(1−) | SUBMITTER |
| 11(S)-hydroxy-14(S),15(S)-epoxy-5(Z),8(Z),12(E)-icosatrienoate(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 11(S)-hydroxy-14(S),15(S)-epoxy-(5Z,8Z,12E)-eicosatrienoate | UniProt |
| Citations |
|---|