EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24O6 |
| Net Charge | 0 |
| Average Mass | 420.461 |
| Monoisotopic Mass | 420.15729 |
| SMILES | CC(C)=CCc1c(O)cc(O)c2c(=O)c3c(oc12)-c1ccc(O)cc1OC3C=C(C)C |
| InChI | InChI=1S/C25H24O6/c1-12(2)5-7-15-17(27)11-18(28)21-23(29)22-20(9-13(3)4)30-19-10-14(26)6-8-16(19)25(22)31-24(15)21/h5-6,8-11,20,26-28H,7H2,1-4H3 |
| InChIKey | SYFDWXWLRGHYAJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morus (ncbitaxon:3497) | - | PubMed (22297755) | From root bark |
| Morus alba (ncbitaxon:3498) | - | PubMed (20815207) | |
| Morus alba var. atropurpurea (ncbitaxon:1453101) | twig (BTO:0001411) | PubMed (19149258) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclomulberrin (CHEBI:132869) has role plant metabolite (CHEBI:76924) |
| cyclomulberrin (CHEBI:132869) has role protective agent (CHEBI:50267) |
| cyclomulberrin (CHEBI:132869) is a chromenochromene (CHEBI:133135) |
| cyclomulberrin (CHEBI:132869) is a cyclic ketone (CHEBI:3992) |
| cyclomulberrin (CHEBI:132869) is a extended flavonoid (CHEBI:71037) |
| cyclomulberrin (CHEBI:132869) is a organic heterotetracyclic compound (CHEBI:38163) |
| cyclomulberrin (CHEBI:132869) is a polyphenol (CHEBI:26195) |
| Incoming Relation(s) |
| cyclomorusin A (CHEBI:132868) has functional parent cyclomulberrin (CHEBI:132869) |
| IUPAC Name |
|---|
| 3,8,10-trihydroxy-11-(3-methylbut-2-en-1-yl)-6-(2-methylprop-1-en-1-yl)-6H,7H-chromeno[4,3-b]chromen-7-one |
| Manual Xrefs | Databases |
|---|---|
| C00004061 | KNApSAcK |
| HMDB0030688 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1631347 | Reaxys |
| CAS:19275-51-5 | HMDB |
| Citations |
|---|