EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22O6 |
| Net Charge | 0 |
| Average Mass | 418.445 |
| Monoisotopic Mass | 418.14164 |
| SMILES | CC(C)=CC1Oc2cc(O)ccc2-c2oc3c4c(cc(O)c3c(=O)c21)OC(C)(C)C=C4 |
| InChI | InChI=1S/C25H22O6/c1-12(2)9-19-21-22(28)20-16(27)11-18-15(7-8-25(3,4)31-18)23(20)30-24(21)14-6-5-13(26)10-17(14)29-19/h5-11,19,26-27H,1-4H3 |
| InChIKey | GDQXJMLXEYSICD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artocarpus altilis (ncbitaxon:194251) | root (BTO:0001188) | PubMed (12662107) | Isolated from root cortex |
| Ficus hirta (ncbitaxon:309429) | root (BTO:0001188) | PubMed (24494557) | |
| Morus alba (ncbitaxon:3498) | root (BTO:0001188) | PubMed (25981820) | Isolated from the root bark |
| Morus alba var. atropurpurea (ncbitaxon:1453101) | twig (BTO:0001411) | PubMed (19149258) | |
| Morus australis (ncbitaxon:66392) | root (BTO:0001188) | PubMed (17405024) | Isolated from the root bark |
| Morus bombycis (ncbitaxon:66393) | root (BTO:0001188) | PubMed (17396934) | Isolated from the root bark |
| Morus lhou (ncbitaxon:226896) | bark (BTO:0001301) | PubMed (18608767) | Isolated from the stem bark |
| Morus nigra (ncbitaxon:85232) | bark (BTO:0001301) | PubMed (18330242) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclomorusin A (CHEBI:132868) has functional parent cyclomulberrin (CHEBI:132869) |
| cyclomorusin A (CHEBI:132868) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| cyclomorusin A (CHEBI:132868) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| cyclomorusin A (CHEBI:132868) has role plant metabolite (CHEBI:76924) |
| cyclomorusin A (CHEBI:132868) has role platelet aggregation inhibitor (CHEBI:50427) |
| cyclomorusin A (CHEBI:132868) is a cyclic ketone (CHEBI:3992) |
| cyclomorusin A (CHEBI:132868) is a extended flavonoid (CHEBI:71037) |
| cyclomorusin A (CHEBI:132868) is a organic heteropentacyclic compound (CHEBI:38164) |
| cyclomorusin A (CHEBI:132868) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 6,11-dihydroxy-3,3-dimethyl-8-(2-methylprop-1-en-1-yl)-3H,7H,8H-chromeno[4,3-b]pyrano[2,3-h]chromen-7-one |
| Synonym | Source |
|---|---|
| cyclomorusin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1442991 | Reaxys |
| CAS:62596-34-3 | ChemIDplus |
| Citations |
|---|