EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N3O2S |
| Net Charge | 0 |
| Average Mass | 249.295 |
| Monoisotopic Mass | 249.05720 |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C11H11N3O2S/c12-9-4-6-10(7-5-9)17(15,16)14-11-3-1-2-8-13-11/h1-8H,12H2,(H,13,14) |
| InChIKey | GECHUMIMRBOMGK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfapyridine (CHEBI:132842) has functional parent sulfanilamide (CHEBI:45373) |
| sulfapyridine (CHEBI:132842) has role antiinfective agent (CHEBI:35441) |
| sulfapyridine (CHEBI:132842) has role dermatologic drug (CHEBI:50177) |
| sulfapyridine (CHEBI:132842) has role drug allergen (CHEBI:88188) |
| sulfapyridine (CHEBI:132842) has role environmental contaminant (CHEBI:78298) |
| sulfapyridine (CHEBI:132842) has role xenobiotic (CHEBI:35703) |
| sulfapyridine (CHEBI:132842) is a pyridines (CHEBI:26421) |
| sulfapyridine (CHEBI:132842) is a substituted aniline (CHEBI:48975) |
| sulfapyridine (CHEBI:132842) is a sulfonamide (CHEBI:35358) |
| sulfapyridine (CHEBI:132842) is a sulfonamide antibiotic (CHEBI:87228) |
| IUPAC Name |
|---|
| 4-amino-N-(pyridin-2-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfapiridina | ChemIDplus |
| sulfapyridine | KEGG DRUG |
| sulfapyridinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(p-Aminobenzenesulphonamido)pyridine | ChemIDplus |
| 2-Sulfanilamidopyridin | ChemIDplus |
| 2-Sulfanilamidopyridine | DrugBank |
| 2-Sulfanilylaminopyridine | DrugBank |
| 2-Sulfapyridine | DrugBank |
| 4-(2-Pyridinylsulfonyl)aniline | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1922 | VSDB |
| 2524 | DrugCentral |
| D02434 | KEGG DRUG |
| DB00891 | DrugBank |
| GB512145 | Patent |
| HMDB0015028 | HMDB |
| LSM-5531 | LINCS |
| Sulfapyridine | Wikipedia |
| US2275354 | Patent |
| Registry Numbers | Sources |
|---|---|
| Gmelin:219135 | Gmelin |
| Reaxys:222065 | Reaxys |
| CAS:144-83-2 | KEGG DRUG |
| CAS:144-83-2 | ChemIDplus |
| CAS:144-83-2 | DrugBank |
| Citations |
|---|