EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16N2O5 |
| Net Charge | 0 |
| Average Mass | 352.346 |
| Monoisotopic Mass | 352.10592 |
| SMILES | Cc1nc(C(=O)NCC(=O)O)c(O)c2ccc(Oc3ccccc3)cc12 |
| InChI | InChI=1S/C19H16N2O5/c1-11-15-9-13(26-12-5-3-2-4-6-12)7-8-14(15)18(24)17(21-11)19(25)20-10-16(22)23/h2-9,24H,10H2,1H3,(H,20,25)(H,22,23) |
| InChIKey | YOZBGTLTNGAVFU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.11.2 (procollagen-proline dioxygenase) inhibitor An EC 1.14.11.* (oxidoreductase acting on paired donors, 2-oxoglutarate as one donor, incorporating 1 atom each of oxygen into both donors) inhibitor that interferes with the action of procollagen-proline dioxygenase (EC 1.14.11.2). EC 1.14.11.29 (hypoxia-inducible factor-proline dioxygenase) inhibitor An EC 1.14.11.* (oxidoreductase acting on paired donors, 2-oxoglutarate as one donor, incorporating 1 atom each of oxygen into both donors) inhibitor that interferes with the action of hypoxia-inducible factor-proline dioxygenase (EC 1.14.11.29). |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roxadustat (CHEBI:132774) has role anti-anaemic agent (CHEBI:75835) |
| roxadustat (CHEBI:132774) has role antineoplastic agent (CHEBI:35610) |
| roxadustat (CHEBI:132774) has role cardiovascular drug (CHEBI:35554) |
| roxadustat (CHEBI:132774) has role EC 1.14.11.2 (procollagen-proline dioxygenase) inhibitor (CHEBI:132365) |
| roxadustat (CHEBI:132774) has role EC 1.14.11.29 (hypoxia-inducible factor-proline dioxygenase) inhibitor (CHEBI:102248) |
| roxadustat (CHEBI:132774) has role renoprotective agent (CHEBI:231911) |
| roxadustat (CHEBI:132774) is a N-acylglycine (CHEBI:16180) |
| roxadustat (CHEBI:132774) is a aromatic ether (CHEBI:35618) |
| roxadustat (CHEBI:132774) is a isoquinolines (CHEBI:24922) |
| IUPAC Name |
|---|
| N-[(4-hydroxy-1-methyl-7-phenoxyisoquinolin-3-yl)carbonyl]glycine |
| INNs | Source |
|---|---|
| roxadustat | WHO MedNet |
| roxadustat | WHO MedNet |
| roxadustat | WHO MedNet |
| roxadustatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| ASP-1517 | ChEMBL |
| ASP1517 | SUBMITTER |
| FG 4592 | ChemIDplus |
| FG-4592 | ChemIDplus |
| FG4592 | ChEBI |
| HIF prolyl-hydroxylase inhibitor | SUBMITTER |
| Brand Name | Source |
|---|---|
| Evrenzo | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D10593 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23352808 | Reaxys |
| CAS:808118-40-3 | ChemIDplus |
| CAS:808118-40-3 | KEGG DRUG |
| Citations |
|---|