EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O3 |
| Net Charge | 0 |
| Average Mass | 328.452 |
| Monoisotopic Mass | 328.20384 |
| SMILES | [H][C@@]12CCc3cc(C(C)C)c(OC)cc3[C@@]1(C)CCC(C(=O)O)=C2C |
| InChI | InChI=1S/C21H28O3/c1-12(2)16-10-14-6-7-17-13(3)15(20(22)23)8-9-21(17,4)18(14)11-19(16)24-5/h10-12,17H,6-9H2,1-5H3,(H,22,23)/t17-,21-/m0/s1 |
| InChIKey | DJRFNRVSOMFEMZ-UWJYYQICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | |||
| - | PubMed (24549173) | ||
| root (BTO:0001188) | Article (Asian Journal of Chemistry . 2014, Vol. 26 Issue 14, p4344-4346) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptohairic acid (CHEBI:132614) has role plant metabolite (CHEBI:76924) |
| triptohairic acid (CHEBI:132614) is a aromatic ether (CHEBI:35618) |
| triptohairic acid (CHEBI:132614) is a tricyclic diterpenoid (CHEBI:79084) |
| triptohairic acid (CHEBI:132614) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (4aS,10aS)-6-methoxy-1,4a-dimethyl-7-(propan-2-yl)-3,4,4a,9,10,10a-hexahydrophenanthrene-2-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8228973 | Reaxys |
| Citations |
|---|